C12H10N2O4S — CID 137068992
methyl 2-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methylideneamino]benzoate (PubChem CID 137068992) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is methyl 2-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methylideneamino]benzoate.
| Compound Name | methyl 2-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 137068992 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | methyl 2-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methylideneamino]benzoate |
| SMILES | COC(=O)c1ccccc1/N=C/c1sc(=O)[nH]c1O |
| InChI | InChI=1S/C12H10N2O4S/c1-18-11(16)7-4-2-3-5-8(7)13-6-9-10(15)14-12(17)19-9/h2-6,15H,1H3,(H,14,17)/b13-6+ |
| InChIKey | MKUQKMNGSDMUOK-AWNIVKPZSA-N |
| XLogP | 1.68 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|