C10H6Cl2N2O2S — CID 137068982
5-[(3,4-dichlorophenyl)iminomethyl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 137068982) has the molecular formula C10H6Cl2N2O2S and a molecular weight of 289.14 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)iminomethyl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[(3,4-dichlorophenyl)iminomethyl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 137068982 |
| Molecular Formula | C10H6Cl2N2O2S |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)iminomethyl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(O)c(/C=N/c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C10H6Cl2N2O2S/c11-6-2-1-5(3-7(6)12)13-4-8-9(15)14-10(16)17-8/h1-4,15H,(H,14,16)/b13-4+ |
| InChIKey | XNSZTHGDVCYPJB-YIXHJXPBSA-N |
| XLogP | 3.20 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|