C12H11N3O2S2 — CID 137068987
N-[4-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylideneamino]phenyl]acetamide (PubChem CID 137068987) has the molecular formula C12H11N3O2S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[4-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylideneamino]phenyl]acetamide.
| Compound Name | N-[4-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylideneamino]phenyl]acetamide |
|---|---|
| PubChem CID | 137068987 |
| Molecular Formula | C12H11N3O2S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-[4-[(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylideneamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/N=C/c2sc(=S)[nH]c2O)cc1 |
| InChI | InChI=1S/C12H11N3O2S2/c1-7(16)14-9-4-2-8(3-5-9)13-6-10-11(17)15-12(18)19-10/h2-6,17H,1H3,(H,14,16)(H,15,18)/b13-6+ |
| InChIKey | XTOUJMBACMRBRX-AWNIVKPZSA-N |
| XLogP | 3.22 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|