C6H10N2O — CID 54472601
4-methyl-3,5-dihydro-1H-1,4-diazepin-2-one (PubChem CID 54472601) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is 4-methyl-3,5-dihydro-1H-1,4-diazepin-2-one.
| Compound Name | 4-methyl-3,5-dihydro-1H-1,4-diazepin-2-one |
|---|---|
| PubChem CID | 54472601 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 4-methyl-3,5-dihydro-1H-1,4-diazepin-2-one |
| SMILES | CN1CC=CNC(=O)C1 |
| InChI | InChI=1S/C6H10N2O/c1-8-4-2-3-7-6(9)5-8/h2-3H,4-5H2,1H3,(H,7,9) |
| InChIKey | XJJKOFFGLVJWDR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |