C24H49NO2 — CID 54473345
4-amino-4-heptadec-8-enylheptane-2,6-diol (PubChem CID 54473345) has the molecular formula C24H49NO2 and a molecular weight of 383.66 g/mol. Its IUPAC name is 4-amino-4-heptadec-8-enylheptane-2,6-diol.
| Compound Name | 4-amino-4-heptadec-8-enylheptane-2,6-diol |
|---|---|
| PubChem CID | 54473345 |
| Molecular Formula | C24H49NO2 |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 383.38 |
| IUPAC Name | 4-amino-4-heptadec-8-enylheptane-2,6-diol |
| SMILES | CCCCCCCCC=CCCCCCCCC(N)(CC(C)O)CC(C)O |
| InChI | InChI=1S/C24H49NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(25,20-22(2)26)21-23(3)27/h11-12,22-23,26-27H,4-10,13-21,25H2,1-3H3 |
| InChIKey | XJUZYEIHDRALQI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|