C21H43NO2 — CID 54365112
2-amino-2-octadec-9-enylpropane-1,3-diol (PubChem CID 54365112) has the molecular formula C21H43NO2 and a molecular weight of 341.58 g/mol. Its IUPAC name is 2-amino-2-octadec-9-enylpropane-1,3-diol.
| Compound Name | 2-amino-2-octadec-9-enylpropane-1,3-diol |
|---|---|
| PubChem CID | 54365112 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | 2-amino-2-octadec-9-enylpropane-1,3-diol |
| SMILES | CCCCCCCCC=CCCCCCCCCC(N)(CO)CO |
| InChI | InChI=1S/C21H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(22,19-23)20-24/h9-10,23-24H,2-8,11-20,22H2,1H3 |
| InChIKey | UPGCXVXNEQOVMJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|