C21H43NO5 — CID 10572438
(E,3R,4R)-2-amino-2-(hydroxymethyl)icos-6-ene-1,3,4,14-tetrol (PubChem CID 10572438) has the molecular formula C21H43NO5 and a molecular weight of 389.58 g/mol. Its IUPAC name is (E,3R,4R)-2-amino-2-(hydroxymethyl)icos-6-ene-1,3,4,14-tetrol.
| Compound Name | (E,3R,4R)-2-amino-2-(hydroxymethyl)icos-6-ene-1,3,4,14-tetrol |
|---|---|
| PubChem CID | 10572438 |
| Molecular Formula | C21H43NO5 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.31 |
| IUPAC Name | (E,3R,4R)-2-amino-2-(hydroxymethyl)icos-6-ene-1,3,4,14-tetrol |
| SMILES | CCCCCCC(O)CCCCCC/C=C/C[C@@H](O)[C@H](O)C(N)(CO)CO |
| InChI | InChI=1S/C21H43NO5/c1-2-3-4-10-13-18(25)14-11-8-6-5-7-9-12-15-19(26)20(27)21(22,16-23)17-24/h9,12,18-20,23-27H,2-8,10-11,13-17,22H2,1H3/b12-9+/t18?,19-,20+/m1/s1 |
| InChIKey | ZPWAKEGUGTYZJD-HYNNSGISSA-N |
| XLogP | 2.01 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|