C34H28N2O4S2 — CID 54476721
1-[2-[[2-(6,7-dimethoxyisoquinolin-1-yl)phenyl]disulfanyl]phenyl]-6,7-dimethoxyisoquinoline (PubChem CID 54476721) has the molecular formula C34H28N2O4S2 and a molecular weight of 592.74 g/mol. Its IUPAC name is 1-[2-[[2-(6,7-dimethoxyisoquinolin-1-yl)phenyl]disulfanyl]phenyl]-6,7-dimethoxyisoquinoline.
| Compound Name | 1-[2-[[2-(6,7-dimethoxyisoquinolin-1-yl)phenyl]disulfanyl]phenyl]-6,7-dimethoxyisoquinoline |
|---|---|
| PubChem CID | 54476721 |
| Molecular Formula | C34H28N2O4S2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 1-[2-[[2-(6,7-dimethoxyisoquinolin-1-yl)phenyl]disulfanyl]phenyl]-6,7-dimethoxyisoquinoline |
| SMILES | COc1cc2ccnc(-c3ccccc3SSc3ccccc3-c3nccc4cc(OC)c(OC)cc34)c2cc1OC |
| InChI | InChI=1S/C34H28N2O4S2/c1-37-27-17-21-13-15-35-33(25(21)19-29(27)39-3)23-9-5-7-11-31(23)41-42-32-12-8-6-10-24(32)34-26-20-30(40-4)28(38-2)18-22(26)14-16-36-34/h5-20H,1-4H3 |
| InChIKey | XMCJFAYDUNRFMY-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|