C9H18BrNO — CID 54477333
2-bromo-N-tert-butyl-N,2-dimethylpropanamide (PubChem CID 54477333) has the molecular formula C9H18BrNO and a molecular weight of 236.15 g/mol. Its IUPAC name is 2-bromo-N-tert-butyl-N,2-dimethylpropanamide.
| Compound Name | 2-bromo-N-tert-butyl-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 54477333 |
| Molecular Formula | C9H18BrNO |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-bromo-N-tert-butyl-N,2-dimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)Br)C(C)(C)C |
| InChI | InChI=1S/C9H18BrNO/c1-8(2,3)11(6)7(12)9(4,5)10/h1-6H3 |
| InChIKey | XMMZSAJQNDLCKW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|