About 2-bromo-N,N-dibutylpropanamide
2-bromo-N,N-dibutylpropanamide (PubChem CID 533067) has the molecular formula C11H22BrNO
and a molecular weight of 264.21 g/mol. Its IUPAC name is 2-bromo-N,N-dibutylpropanamide.
Molecular Properties
| Compound Name | 2-bromo-N,N-dibutylpropanamide |
| PubChem CID | 533067 |
| Molecular Formula | C11H22BrNO |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-bromo-N,N-dibutylpropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(C)Br |
| InChI | InChI=1S/C11H22BrNO/c1-4-6-8-13(9-7-5-2)11(14)10(3)12/h10H,4-9H2,1-3H3 |
| InChIKey | YODUIZXBBCYMFR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N,N-dibutylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N-dibutylpropanamide?
The IUPAC name of 2-bromo-N,N-dibutylpropanamide (CID 533067) is 2-bromo-N,N-dibutylpropanamide.
What is the SMILES notation for 2-bromo-N,N-dibutylpropanamide?
The canonical SMILES for 2-bromo-N,N-dibutylpropanamide is CCCCN(CCCC)C(=O)C(C)Br.
What is the InChIKey of 2-bromo-N,N-dibutylpropanamide?
The InChIKey is YODUIZXBBCYMFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22BrNO/c1-4-6-8-13(9-7-5-2)11(14)10(3)12/h10H,4-9H2,1-3H3.
What are the key properties of 2-bromo-N,N-dibutylpropanamide?
2-bromo-N,N-dibutylpropanamide has a molecular weight of 264.21 g/mol, XLogP of 3.20, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N-dibutylpropanamide is sourced from PubChem (CID 533067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).