C24H30ClNO3 — CID 54477565
methyl 8-(N-(4-chlorobenzoyl)-2,6-dimethylanilino)octanoate (PubChem CID 54477565) has the molecular formula C24H30ClNO3 and a molecular weight of 415.96 g/mol. Its IUPAC name is methyl 8-(N-(4-chlorobenzoyl)-2,6-dimethylanilino)octanoate.
| Compound Name | methyl 8-(N-(4-chlorobenzoyl)-2,6-dimethylanilino)octanoate |
|---|---|
| PubChem CID | 54477565 |
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | methyl 8-(N-(4-chlorobenzoyl)-2,6-dimethylanilino)octanoate |
| SMILES | COC(=O)CCCCCCCN(C(=O)c1ccc(Cl)cc1)c1c(C)cccc1C |
| InChI | InChI=1S/C24H30ClNO3/c1-18-10-9-11-19(2)23(18)26(24(28)20-13-15-21(25)16-14-20)17-8-6-4-5-7-12-22(27)29-3/h9-11,13-16H,4-8,12,17H2,1-3H3 |
| InChIKey | XMQZICQSBYGYLS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|