C29H31ClN2O4 — CID 88762425
4-(N-[3-(4-chlorophenyl)-2-(2,6-dimethylanilino)-3-oxopropanoyl]-2,6-dimethylanilino)butanoic acid (PubChem CID 88762425) has the molecular formula C29H31ClN2O4 and a molecular weight of 507.03 g/mol. Its IUPAC name is 4-(N-[3-(4-chlorophenyl)-2-(2,6-dimethylanilino)-3-oxopropanoyl]-2,6-dimethylanilino)butanoic acid.
| Compound Name | 4-(N-[3-(4-chlorophenyl)-2-(2,6-dimethylanilino)-3-oxopropanoyl]-2,6-dimethylanilino)butanoic acid |
|---|---|
| PubChem CID | 88762425 |
| Molecular Formula | C29H31ClN2O4 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 4-(N-[3-(4-chlorophenyl)-2-(2,6-dimethylanilino)-3-oxopropanoyl]-2,6-dimethylanilino)butanoic acid |
| SMILES | Cc1cccc(C)c1NC(C(=O)c1ccc(Cl)cc1)C(=O)N(CCCC(=O)O)c1c(C)cccc1C |
| InChI | InChI=1S/C29H31ClN2O4/c1-18-8-5-9-19(2)25(18)31-26(28(35)22-13-15-23(30)16-14-22)29(36)32(17-7-12-24(33)34)27-20(3)10-6-11-21(27)4/h5-6,8-11,13-16,26,31H,7,12,17H2,1-4H3,(H,33,34) |
| InChIKey | LPZNMANIMVSZJQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|