C28H40O3 — CID 54478731
2-[(2S)-2-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propylidene]-5-methylcyclopentan-1-one (PubChem CID 54478731) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is 2-[(2S)-2-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propylidene]-5-methylcyclopentan-1-one.
| Compound Name | 2-[(2S)-2-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propylidene]-5-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 54478731 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 2-[(2S)-2-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propylidene]-5-methylcyclopentan-1-one |
| SMILES | C=C1C(=CC=C2CCC[C@@]3(C)C2CC[C@@H]3[C@@H](C)C=C2CCC(C)C2=O)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C28H40O3/c1-17-7-8-22(27(17)31)14-18(2)24-11-12-25-20(6-5-13-28(24,25)4)9-10-21-15-23(29)16-26(30)19(21)3/h9-10,14,17-18,23-26,29-30H,3,5-8,11-13,15-16H2,1-2,4H3/t17?,18-,23+,24+,25?,26-,28+/m0/s1 |
| InChIKey | XNMCTEILSPFWFQ-UWHPSIHPSA-N |
| XLogP | 5.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|