C17H13F6NO2 — CID 54479423
1,1,1,3,3,3-hexafluoropropan-2-yl 2-anilino-2-phenylacetate (PubChem CID 54479423) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-anilino-2-phenylacetate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 54479423 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-anilino-2-phenylacetate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13F6NO2/c18-16(19,20)15(17(21,22)23)26-14(25)13(11-7-3-1-4-8-11)24-12-9-5-2-6-10-12/h1-10,13,15,24H |
| InChIKey | XNYCSLDYFVSLAR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |