C38H32N2 — CID 54480276
4-(4-methylphenyl)-3-[2-(4-methylphenyl)phenyl]-5,6-diphenylbenzene-1,2-diamine (PubChem CID 54480276) has the molecular formula C38H32N2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-[2-(4-methylphenyl)phenyl]-5,6-diphenylbenzene-1,2-diamine.
| Compound Name | 4-(4-methylphenyl)-3-[2-(4-methylphenyl)phenyl]-5,6-diphenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 54480276 |
| Molecular Formula | C38H32N2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 4-(4-methylphenyl)-3-[2-(4-methylphenyl)phenyl]-5,6-diphenylbenzene-1,2-diamine |
| SMILES | Cc1ccc(-c2ccccc2-c2c(N)c(N)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C38H32N2/c1-25-17-21-27(22-18-25)31-15-9-10-16-32(31)36-34(30-23-19-26(2)20-24-30)33(28-11-5-3-6-12-28)35(37(39)38(36)40)29-13-7-4-8-14-29/h3-24H,39-40H2,1-2H3 |
| InChIKey | XOMSPPNAUVUHKJ-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|