C14H15NO2S — CID 54483379
2-(2-sulfanylethyl)-4,5-dihydrobenzo[e]isoindole-1,3-diol (PubChem CID 54483379) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(2-sulfanylethyl)-4,5-dihydrobenzo[e]isoindole-1,3-diol.
| Compound Name | 2-(2-sulfanylethyl)-4,5-dihydrobenzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 54483379 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-(2-sulfanylethyl)-4,5-dihydrobenzo[e]isoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCS)-c1ccccc1CC2 |
| InChI | InChI=1S/C14H15NO2S/c16-13-11-6-5-9-3-1-2-4-10(9)12(11)14(17)15(13)7-8-18/h1-4,16-18H,5-8H2 |
| InChIKey | XQOYXJOQKQGIOV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|