C19H24N2O5 — CID 54486492
(2S)-2-hydroxy-3-[[1-[(1-oxo-4-phenylbutan-2-ylidene)amino]cyclopentanecarbonyl]amino]propanoic acid (PubChem CID 54486492) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[[1-[(1-oxo-4-phenylbutan-2-ylidene)amino]cyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[[1-[(1-oxo-4-phenylbutan-2-ylidene)amino]cyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54486492 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (2S)-2-hydroxy-3-[[1-[(1-oxo-4-phenylbutan-2-ylidene)amino]cyclopentanecarbonyl]amino]propanoic acid |
| SMILES | O=C/C(CCc1ccccc1)=N\C1(C(=O)NC[C@H](O)C(=O)O)CCCC1 |
| InChI | InChI=1S/C19H24N2O5/c22-13-15(9-8-14-6-2-1-3-7-14)21-19(10-4-5-11-19)18(26)20-12-16(23)17(24)25/h1-3,6-7,13,16,23H,4-5,8-12H2,(H,20,26)(H,24,25)/b21-15-/t16-/m0/s1 |
| InChIKey | XSRFGBXYEWLVNQ-NOEYKIMYSA-N |
| XLogP | 1.13 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|