C24H22BrNO — CID 54488605
1-[(1R)-1-(3-bromophenyl)prop-2-enyl]-7-phenylmethoxy-2,3-dihydroindole (PubChem CID 54488605) has the molecular formula C24H22BrNO and a molecular weight of 420.35 g/mol. Its IUPAC name is 1-[(1R)-1-(3-bromophenyl)prop-2-enyl]-7-phenylmethoxy-2,3-dihydroindole.
| Compound Name | 1-[(1R)-1-(3-bromophenyl)prop-2-enyl]-7-phenylmethoxy-2,3-dihydroindole |
|---|---|
| PubChem CID | 54488605 |
| Molecular Formula | C24H22BrNO |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 1-[(1R)-1-(3-bromophenyl)prop-2-enyl]-7-phenylmethoxy-2,3-dihydroindole |
| SMILES | C=C[C@H](c1cccc(Br)c1)N1CCc2cccc(OCc3ccccc3)c21 |
| InChI | InChI=1S/C24H22BrNO/c1-2-22(20-11-6-12-21(25)16-20)26-15-14-19-10-7-13-23(24(19)26)27-17-18-8-4-3-5-9-18/h2-13,16,22H,1,14-15,17H2/t22-/m1/s1 |
| InChIKey | XUDNFDWEROCTPK-JOCHJYFZSA-N |
| XLogP | 6.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|