C34H27F3N2O7S — CID 54491424
trifluoromethanesulfonate;(2,4,6-trimethylphenyl) 2-[(1,3-dioxoisoindol-2-yl)methyl]-10-methylacridin-10-ium-9-carboxylate (PubChem CID 54491424) has the molecular formula C34H27F3N2O7S and a molecular weight of 664.66 g/mol. Its IUPAC name is trifluoromethanesulfonate;(2,4,6-trimethylphenyl) 2-[(1,3-dioxoisoindol-2-yl)methyl]-10-methylacridin-10-ium-9-carboxylate.
| Compound Name | trifluoromethanesulfonate;(2,4,6-trimethylphenyl) 2-[(1,3-dioxoisoindol-2-yl)methyl]-10-methylacridin-10-ium-9-carboxylate |
|---|---|
| PubChem CID | 54491424 |
| Molecular Formula | C34H27F3N2O7S |
| Molecular Weight | 664.66 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | trifluoromethanesulfonate;(2,4,6-trimethylphenyl) 2-[(1,3-dioxoisoindol-2-yl)methyl]-10-methylacridin-10-ium-9-carboxylate |
| SMILES | Cc1cc(C)c(OC(=O)c2c3ccccc3[n+](C)c3ccc(CN4C(=O)c5ccccc5C4=O)cc23)c(C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C33H27N2O4.CHF3O3S/c1-19-15-20(2)30(21(3)16-19)39-33(38)29-25-11-7-8-12-27(25)34(4)28-14-13-22(17-26(28)29)18-35-31(36)23-9-5-6-10-24(23)32(35)37;2-1(3,4)8(5,6)7/h5-17H,18H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | XVZNXTICHXZYGF-UHFFFAOYSA-M |
| XLogP | 5.81 |
| TPSA | 124.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|