C17H12IN3O — CID 54491943
4-(imidazol-1-ylmethyl)-2-(2-iodophenoxy)benzonitrile (PubChem CID 54491943) has the molecular formula C17H12IN3O and a molecular weight of 401.21 g/mol. Its IUPAC name is 4-(imidazol-1-ylmethyl)-2-(2-iodophenoxy)benzonitrile.
| Compound Name | 4-(imidazol-1-ylmethyl)-2-(2-iodophenoxy)benzonitrile |
|---|---|
| PubChem CID | 54491943 |
| Molecular Formula | C17H12IN3O |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 4-(imidazol-1-ylmethyl)-2-(2-iodophenoxy)benzonitrile |
| SMILES | N#Cc1ccc(Cn2ccnc2)cc1Oc1ccccc1I |
| InChI | InChI=1S/C17H12IN3O/c18-15-3-1-2-4-16(15)22-17-9-13(5-6-14(17)10-19)11-21-8-7-20-12-21/h1-9,12H,11H2 |
| InChIKey | XWIUGIWRFSEDMW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|