C22H38O5 — CID 54492830
[2-ethyl-2-[3-(2-methylprop-2-enoyloxymethyl)hexan-3-yloxy]pentyl] 2-methylprop-2-enoate (PubChem CID 54492830) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is [2-ethyl-2-[3-(2-methylprop-2-enoyloxymethyl)hexan-3-yloxy]pentyl] 2-methylprop-2-enoate.
| Compound Name | [2-ethyl-2-[3-(2-methylprop-2-enoyloxymethyl)hexan-3-yloxy]pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54492830 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | [2-ethyl-2-[3-(2-methylprop-2-enoyloxymethyl)hexan-3-yloxy]pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)(CCC)OC(CC)(CCC)COC(=O)C(=C)C |
| InChI | InChI=1S/C22H38O5/c1-9-13-21(11-3,15-25-19(23)17(5)6)27-22(12-4,14-10-2)16-26-20(24)18(7)8/h5,7,9-16H2,1-4,6,8H3 |
| InChIKey | XWZCQYGJFYTTFX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|