About methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene
methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene (PubChem CID 54499924) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene |
| PubChem CID | 54499924 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(C)OC.CCOC |
| InChI | InChI=1S/C4H8O.C4H8.C3H8O/c1-4(2)5-3;1-4(2)3;1-3-4-2/h1H2,2-3H3;1H2,2-3H3;3H2,1-2H3 |
| InChIKey | YBSALCQENVZDBF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene?
The IUPAC name of methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene (CID 54499924) is methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene.
What is the SMILES notation for methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene?
The canonical SMILES for methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene is C=C(C)C.C=C(C)OC.CCOC.
What is the InChIKey of methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene?
The InChIKey is YBSALCQENVZDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C4H8.C3H8O/c1-4(2)5-3;1-4(2)3;1-3-4-2/h1H2,2-3H3;1H2,2-3H3;3H2,1-2H3.
What are the key properties of methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene?
methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene has a molecular weight of 188.31 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyethane;2-methoxyprop-1-ene;2-methylprop-1-ene is sourced from PubChem (CID 54499924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).