About ethenoxyethene;2-methoxyprop-1-ene
ethenoxyethene;2-methoxyprop-1-ene (PubChem CID 21481982) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is ethenoxyethene;2-methoxyprop-1-ene.
Molecular Properties
| Compound Name | ethenoxyethene;2-methoxyprop-1-ene |
| PubChem CID | 21481982 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | ethenoxyethene;2-methoxyprop-1-ene |
| SMILES | C=C(C)OC.C=COC=C |
| InChI | InChI=1S/C4H8O.C4H6O/c1-4(2)5-3;1-3-5-4-2/h1H2,2-3H3;3-4H,1-2H2 |
| InChIKey | XMPZAWPCSOIHFX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenoxyethene;2-methoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxyethene;2-methoxyprop-1-ene?
The IUPAC name of ethenoxyethene;2-methoxyprop-1-ene (CID 21481982) is ethenoxyethene;2-methoxyprop-1-ene.
What is the SMILES notation for ethenoxyethene;2-methoxyprop-1-ene?
The canonical SMILES for ethenoxyethene;2-methoxyprop-1-ene is C=C(C)OC.C=COC=C.
What is the InChIKey of ethenoxyethene;2-methoxyprop-1-ene?
The InChIKey is XMPZAWPCSOIHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C4H6O/c1-4(2)5-3;1-3-5-4-2/h1H2,2-3H3;3-4H,1-2H2.
What are the key properties of ethenoxyethene;2-methoxyprop-1-ene?
ethenoxyethene;2-methoxyprop-1-ene has a molecular weight of 142.20 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethene;2-methoxyprop-1-ene is sourced from PubChem (CID 21481982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).