C30H56O8 — CID 54500503
[5,6-dihydroxy-2,3-di(octanoyloxy)hexyl] octanoate (PubChem CID 54500503) has the molecular formula C30H56O8 and a molecular weight of 544.77 g/mol. Its IUPAC name is [5,6-dihydroxy-2,3-di(octanoyloxy)hexyl] octanoate.
| Compound Name | [5,6-dihydroxy-2,3-di(octanoyloxy)hexyl] octanoate |
|---|---|
| PubChem CID | 54500503 |
| Molecular Formula | C30H56O8 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | [5,6-dihydroxy-2,3-di(octanoyloxy)hexyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(OC(=O)CCCCCCC)C(CC(O)CO)OC(=O)CCCCCCC |
| InChI | InChI=1S/C30H56O8/c1-4-7-10-13-16-19-28(33)36-24-27(38-30(35)21-18-15-12-9-6-3)26(22-25(32)23-31)37-29(34)20-17-14-11-8-5-2/h25-27,31-32H,4-24H2,1-3H3 |
| InChIKey | YCBUGAADQHJAPT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|