C38H70O10 — CID 90723912
2,3-dihydroxypropyl 9,10,11-tri(octanoyloxy)undecanoate (PubChem CID 90723912) has the molecular formula C38H70O10 and a molecular weight of 686.97 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 9,10,11-tri(octanoyloxy)undecanoate.
| Compound Name | 2,3-dihydroxypropyl 9,10,11-tri(octanoyloxy)undecanoate |
|---|---|
| PubChem CID | 90723912 |
| Molecular Formula | C38H70O10 |
| Molecular Weight | 686.97 g/mol |
| Exact Mass | 686.50 |
| IUPAC Name | 2,3-dihydroxypropyl 9,10,11-tri(octanoyloxy)undecanoate |
| SMILES | CCCCCCCC(=O)OCC(OC(=O)CCCCCCC)C(CCCCCCCC(=O)OCC(O)CO)OC(=O)CCCCCCC |
| InChI | InChI=1S/C38H70O10/c1-4-7-10-14-20-26-36(42)46-31-34(48-38(44)28-23-16-12-9-6-3)33(47-37(43)27-22-15-11-8-5-2)24-19-17-13-18-21-25-35(41)45-30-32(40)29-39/h32-34,39-40H,4-31H2,1-3H3 |
| InChIKey | NHUXRSMOEORTLM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.97 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|