C26H42FNO8Si — CID 54500589
methyl 3-[4-fluoro-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]prop-2-enoate (PubChem CID 54500589) has the molecular formula C26H42FNO8Si and a molecular weight of 543.71 g/mol. Its IUPAC name is methyl 3-[4-fluoro-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-fluoro-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54500589 |
| Molecular Formula | C26H42FNO8Si |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | methyl 3-[4-fluoro-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]prop-2-enoate |
| SMILES | CCO[Si](CCCNC(=O)OCCCCCCOc1cc(C=CC(=O)OC)ccc1F)(OCC)OCC |
| InChI | InChI=1S/C26H42FNO8Si/c1-5-34-37(35-6-2,36-7-3)20-12-17-28-26(30)33-19-11-9-8-10-18-32-24-21-22(13-15-23(24)27)14-16-25(29)31-4/h13-16,21H,5-12,17-20H2,1-4H3,(H,28,30) |
| InChIKey | YCCZKTRGIZOLBB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|