C32H46FNO8Si — CID 54289815
methyl 3-[2-fluoro-4-[4-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]phenyl]prop-2-enoate (PubChem CID 54289815) has the molecular formula C32H46FNO8Si and a molecular weight of 619.80 g/mol. Its IUPAC name is methyl 3-[2-fluoro-4-[4-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[2-fluoro-4-[4-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54289815 |
| Molecular Formula | C32H46FNO8Si |
| Molecular Weight | 619.80 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | methyl 3-[2-fluoro-4-[4-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]phenyl]prop-2-enoate |
| SMILES | CCO[Si](CCCNC(=O)OCCCCCCOc1ccc(-c2ccc(C=CC(=O)OC)c(F)c2)cc1)(OCC)OCC |
| InChI | InChI=1S/C32H46FNO8Si/c1-5-40-43(41-6-2,42-7-3)24-12-21-34-32(36)39-23-11-9-8-10-22-38-29-18-15-26(16-19-29)28-14-13-27(30(33)25-28)17-20-31(35)37-4/h13-20,25H,5-12,21-24H2,1-4H3,(H,34,36) |
| InChIKey | RWRVOEGIPPQSIZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.80 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|