C34H45F8NO8Si — CID 58609424
6-[4-[4-[(3-ethyloxetan-3-yl)methoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]hexyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 58609424) has the molecular formula C34H45F8NO8Si and a molecular weight of 775.80 g/mol. Its IUPAC name is 6-[4-[4-[(3-ethyloxetan-3-yl)methoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]hexyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | 6-[4-[4-[(3-ethyloxetan-3-yl)methoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]hexyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 58609424 |
| Molecular Formula | C34H45F8NO8Si |
| Molecular Weight | 775.80 g/mol |
| Exact Mass | 775.28 |
| IUPAC Name | 6-[4-[4-[(3-ethyloxetan-3-yl)methoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]hexyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCCCCCCOc1c(F)c(F)c(-c2c(F)c(F)c(OCC3(CC)COC3)c(F)c2F)c(F)c1F)(OCC)OCC |
| InChI | InChI=1S/C34H45F8NO8Si/c1-5-34(18-45-19-34)20-48-32-29(41)25(37)22(26(38)30(32)42)21-23(35)27(39)31(28(40)24(21)36)46-15-11-9-10-12-16-47-33(44)43-14-13-17-52(49-6-2,50-7-3)51-8-4/h5-20H2,1-4H3,(H,43,44) |
| InChIKey | FOCRSHFEGMMTNU-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.80 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|