C34H41NO2 — CID 54501588
N-[1-(6H-benzo[c][1]benzoxepin-3-ylidene)propyl]-6-(4-tert-butylphenyl)-N-methylhexanamide (PubChem CID 54501588) has the molecular formula C34H41NO2 and a molecular weight of 495.71 g/mol. Its IUPAC name is N-[1-(6H-benzo[c][1]benzoxepin-3-ylidene)propyl]-6-(4-tert-butylphenyl)-N-methylhexanamide.
| Compound Name | N-[1-(6H-benzo[c][1]benzoxepin-3-ylidene)propyl]-6-(4-tert-butylphenyl)-N-methylhexanamide |
|---|---|
| PubChem CID | 54501588 |
| Molecular Formula | C34H41NO2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | N-[1-(6H-benzo[c][1]benzoxepin-3-ylidene)propyl]-6-(4-tert-butylphenyl)-N-methylhexanamide |
| SMILES | CCC(=c1ccc2c(c1)OCc1ccccc1C=2)N(C)C(=O)CCCCCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H41NO2/c1-6-31(27-18-19-28-22-26-13-10-11-14-29(26)24-37-32(28)23-27)35(5)33(36)15-9-7-8-12-25-16-20-30(21-17-25)34(2,3)4/h10-11,13-14,16-23H,6-9,12,15,24H2,1-5H3 |
| InChIKey | YCUNIUXKVFIRFS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|