C22H19FN6O3S — CID 54506646
2-[[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-6-fluoro-1H-benzimidazol-2-yl]methyl]-1,3-benzothiazole-6-carboximidamide (PubChem CID 54506646) has the molecular formula C22H19FN6O3S and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-[[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-6-fluoro-1H-benzimidazol-2-yl]methyl]-1,3-benzothiazole-6-carboximidamide.
| Compound Name | 2-[[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-6-fluoro-1H-benzimidazol-2-yl]methyl]-1,3-benzothiazole-6-carboximidamide |
|---|---|
| PubChem CID | 54506646 |
| Molecular Formula | C22H19FN6O3S |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-[[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-6-fluoro-1H-benzimidazol-2-yl]methyl]-1,3-benzothiazole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(Cc3nc4c(OCCn5c(O)ccc5O)cc(F)cc4[nH]3)sc2c1 |
| InChI | InChI=1S/C22H19FN6O3S/c23-12-8-14-21(15(9-12)32-6-5-29-19(30)3-4-20(29)31)28-17(26-14)10-18-27-13-2-1-11(22(24)25)7-16(13)33-18/h1-4,7-9,30-31H,5-6,10H2,(H3,24,25)(H,26,28) |
| InChIKey | YGEJYNYKYXBYHW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|