C27H28N8 — CID 54509546
4-[2-[5-propan-2-yl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethyl]aniline (PubChem CID 54509546) has the molecular formula C27H28N8 and a molecular weight of 464.58 g/mol. Its IUPAC name is 4-[2-[5-propan-2-yl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethyl]aniline.
| Compound Name | 4-[2-[5-propan-2-yl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethyl]aniline |
|---|---|
| PubChem CID | 54509546 |
| Molecular Formula | C27H28N8 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 4-[2-[5-propan-2-yl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethyl]aniline |
| SMILES | CC(C)c1nc(CCc2ccc(N)cc2)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C27H28N8/c1-18(2)26-29-25(16-11-19-9-14-22(28)15-10-19)35(32-26)17-20-7-12-21(13-8-20)23-5-3-4-6-24(23)27-30-33-34-31-27/h3-10,12-15,18H,11,16-17,28H2,1-2H3,(H,30,31,33,34) |
| InChIKey | YIDJGQGVCCFUTK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|