C10H6N4 — CID 54512965
(4-cyanoimino-2-ethenylcyclohexa-2,5-dien-1-ylidene)cyanamide (PubChem CID 54512965) has the molecular formula C10H6N4 and a molecular weight of 182.19 g/mol. Its IUPAC name is (4-cyanoimino-2-ethenylcyclohexa-2,5-dien-1-ylidene)cyanamide.
| Compound Name | (4-cyanoimino-2-ethenylcyclohexa-2,5-dien-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 54512965 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (4-cyanoimino-2-ethenylcyclohexa-2,5-dien-1-ylidene)cyanamide |
| SMILES | C=CC1=C/C(=N/C#N)C=C/C1=N\C#N |
| InChI | InChI=1S/C10H6N4/c1-2-8-5-9(13-6-11)3-4-10(8)14-7-12/h2-5H,1H2/b13-9+,14-10+ |
| InChIKey | YKLBBJBDTVTQBD-UTLPMFLDSA-N |
| XLogP | 1.51 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|