C17H22N2O5S — CID 54513101
[5-(methoxymethoxy)-1-methylpyrazol-4-yl]-(2,3,5-trimethyl-4-methylsulfonylphenyl)methanone (PubChem CID 54513101) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is [5-(methoxymethoxy)-1-methylpyrazol-4-yl]-(2,3,5-trimethyl-4-methylsulfonylphenyl)methanone.
| Compound Name | [5-(methoxymethoxy)-1-methylpyrazol-4-yl]-(2,3,5-trimethyl-4-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 54513101 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [5-(methoxymethoxy)-1-methylpyrazol-4-yl]-(2,3,5-trimethyl-4-methylsulfonylphenyl)methanone |
| SMILES | COCOc1c(C(=O)c2cc(C)c(S(C)(=O)=O)c(C)c2C)cnn1C |
| InChI | InChI=1S/C17H22N2O5S/c1-10-7-13(11(2)12(3)16(10)25(6,21)22)15(20)14-8-18-19(4)17(14)24-9-23-5/h7-8H,9H2,1-6H3 |
| InChIKey | YKNHUNBYOGUJJF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|