About [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate
[4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate (PubChem CID 54158764) has the molecular formula C18H21ClN2O6S
and a molecular weight of 428.89 g/mol. Its IUPAC name is [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate |
| PubChem CID | 54158764 |
| Molecular Formula | C18H21ClN2O6S |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1c(C(=O)c2cc(C)c(S(C)(=O)=O)c(C)c2Cl)cnn1CC |
| InChI | InChI=1S/C18H21ClN2O6S/c1-6-21-17(27-18(23)26-7-2)13(9-20-21)15(22)12-8-10(3)16(28(5,24)25)11(4)14(12)19/h8-9H,6-7H2,1-5H3 |
| InChIKey | OMYDXUVKHKINPT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate?
The IUPAC name of [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate (CID 54158764) is [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate.
What is the SMILES notation for [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate?
The canonical SMILES for [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate is CCOC(=O)Oc1c(C(=O)c2cc(C)c(S(C)(=O)=O)c(C)c2Cl)cnn1CC.
What is the InChIKey of [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate?
The InChIKey is OMYDXUVKHKINPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN2O6S/c1-6-21-17(27-18(23)26-7-2)13(9-20-21)15(22)12-8-10(3)16(28(5,24)25)11(4)14(12)19/h8-9H,6-7H2,1-5H3.
What are the key properties of [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate?
[4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate has a molecular weight of 428.89 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-chloro-3,5-dimethyl-4-methylsulfonylbenzoyl)-1-ethylpyrazol-5-yl] ethyl carbonate is sourced from PubChem (CID 54158764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).