C22H24FN3O2 — CID 54513941
N-[4-[(4-fluorophenyl)methyl]-2-methoxypiperidin-1-yl]-1H-indole-5-carboxamide (PubChem CID 54513941) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is N-[4-[(4-fluorophenyl)methyl]-2-methoxypiperidin-1-yl]-1H-indole-5-carboxamide.
| Compound Name | N-[4-[(4-fluorophenyl)methyl]-2-methoxypiperidin-1-yl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 54513941 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[4-[(4-fluorophenyl)methyl]-2-methoxypiperidin-1-yl]-1H-indole-5-carboxamide |
| SMILES | COC1CC(Cc2ccc(F)cc2)CCN1NC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C22H24FN3O2/c1-28-21-13-16(12-15-2-5-19(23)6-3-15)9-11-26(21)25-22(27)18-4-7-20-17(14-18)8-10-24-20/h2-8,10,14,16,21,24H,9,11-13H2,1H3,(H,25,27) |
| InChIKey | YLBSNQMBTTUPON-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |