C15H18N4OS — CID 54519971
N-(3-methoxyphenyl)-N'-(1,3-thiazol-2-yl)pyrrolidine-1-carboximidamide (PubChem CID 54519971) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-N'-(1,3-thiazol-2-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-(3-methoxyphenyl)-N'-(1,3-thiazol-2-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 54519971 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-(3-methoxyphenyl)-N'-(1,3-thiazol-2-yl)pyrrolidine-1-carboximidamide |
| SMILES | COc1cccc(NC(=Nc2nccs2)N2CCCC2)c1 |
| InChI | InChI=1S/C15H18N4OS/c1-20-13-6-4-5-12(11-13)17-14(19-8-2-3-9-19)18-15-16-7-10-21-15/h4-7,10-11H,2-3,8-9H2,1H3,(H,16,17,18) |
| InChIKey | YPCGYKPVLCLBRX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|