About 6aH-3-benzazocin-4-one
6aH-3-benzazocin-4-one (PubChem CID 54522036) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 6aH-3-benzazocin-4-one.
Molecular Properties
| Compound Name | 6aH-3-benzazocin-4-one |
| PubChem CID | 54522036 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 6aH-3-benzazocin-4-one |
| SMILES | O=C1C=CC2C=CC=CC2=C/C=N\1 |
| InChI | InChI=1S/C11H9NO/c13-11-6-5-9-3-1-2-4-10(9)7-8-12-11/h1-9H/b6-5?,10-7?,12-8- |
| InChIKey | YQMGJINRPQXDCN-KMPOYQSZSA-N |
| XLogP | 1.82 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6aH-3-benzazocin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6aH-3-benzazocin-4-one?
The IUPAC name of 6aH-3-benzazocin-4-one (CID 54522036) is 6aH-3-benzazocin-4-one.
What is the SMILES notation for 6aH-3-benzazocin-4-one?
The canonical SMILES for 6aH-3-benzazocin-4-one is O=C1C=CC2C=CC=CC2=C/C=N\1.
What is the InChIKey of 6aH-3-benzazocin-4-one?
The InChIKey is YQMGJINRPQXDCN-KMPOYQSZSA-N. The full InChI is InChI=1S/C11H9NO/c13-11-6-5-9-3-1-2-4-10(9)7-8-12-11/h1-9H/b6-5?,10-7?,12-8-.
What are the key properties of 6aH-3-benzazocin-4-one?
6aH-3-benzazocin-4-one has a molecular weight of 171.20 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6aH-3-benzazocin-4-one is sourced from PubChem (CID 54522036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).