About 3-benzazepin-2-one;dihydrate
3-benzazepin-2-one;dihydrate (PubChem CID 172782250) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 3-benzazepin-2-one;dihydrate.
Molecular Properties
| Compound Name | 3-benzazepin-2-one;dihydrate |
| PubChem CID | 172782250 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-benzazepin-2-one;dihydrate |
| SMILES | O.O.O=c1cc2ccccc2ccn1 |
| InChI | InChI=1S/C10H7NO.2H2O/c12-10-7-9-4-2-1-3-8(9)5-6-11-10;;/h1-7H;2*1H2 |
| InChIKey | OKLGOCQOWMJCQQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzazepin-2-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzazepin-2-one;dihydrate?
The IUPAC name of 3-benzazepin-2-one;dihydrate (CID 172782250) is 3-benzazepin-2-one;dihydrate.
What is the SMILES notation for 3-benzazepin-2-one;dihydrate?
The canonical SMILES for 3-benzazepin-2-one;dihydrate is O.O.O=c1cc2ccccc2ccn1.
What is the InChIKey of 3-benzazepin-2-one;dihydrate?
The InChIKey is OKLGOCQOWMJCQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO.2H2O/c12-10-7-9-4-2-1-3-8(9)5-6-11-10;;/h1-7H;2*1H2.
What are the key properties of 3-benzazepin-2-one;dihydrate?
3-benzazepin-2-one;dihydrate has a molecular weight of 193.20 g/mol, XLogP of -0.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzazepin-2-one;dihydrate is sourced from PubChem (CID 172782250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).