C13H15N3O6S — CID 54522853
2-[[5-(2-hydroxyethylcarbamoyl)-3-oxo-1H-pyrazol-2-yl]methyl]benzenesulfonic acid (PubChem CID 54522853) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is 2-[[5-(2-hydroxyethylcarbamoyl)-3-oxo-1H-pyrazol-2-yl]methyl]benzenesulfonic acid.
| Compound Name | 2-[[5-(2-hydroxyethylcarbamoyl)-3-oxo-1H-pyrazol-2-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54522853 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-[[5-(2-hydroxyethylcarbamoyl)-3-oxo-1H-pyrazol-2-yl]methyl]benzenesulfonic acid |
| SMILES | O=C(NCCO)c1cc(=O)n(Cc2ccccc2S(=O)(=O)O)[nH]1 |
| InChI | InChI=1S/C13H15N3O6S/c17-6-5-14-13(19)10-7-12(18)16(15-10)8-9-3-1-2-4-11(9)23(20,21)22/h1-4,7,15,17H,5-6,8H2,(H,14,19)(H,20,21,22) |
| InChIKey | YRBAGLCBHMQOGA-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|