C14H17F9O2 — CID 54524487
2-methylbutan-2-yl 3,3,4,4,5,5,6,6,7-nonafluoro-2-methylideneoctanoate (PubChem CID 54524487) has the molecular formula C14H17F9O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-methylbutan-2-yl 3,3,4,4,5,5,6,6,7-nonafluoro-2-methylideneoctanoate.
| Compound Name | 2-methylbutan-2-yl 3,3,4,4,5,5,6,6,7-nonafluoro-2-methylideneoctanoate |
|---|---|
| PubChem CID | 54524487 |
| Molecular Formula | C14H17F9O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-methylbutan-2-yl 3,3,4,4,5,5,6,6,7-nonafluoro-2-methylideneoctanoate |
| SMILES | C=C(C(=O)OC(C)(C)CC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/C14H17F9O2/c1-6-10(4,5)25-9(24)7(2)11(16,17)13(20,21)14(22,23)12(18,19)8(3)15/h8H,2,6H2,1,3-5H3 |
| InChIKey | YSEAAFRNLOJRKH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|