C20H24ClN5O — CID 54529890
N-[4-[1-(4-chlorophenyl)ethylamino]-6-(2-methylprop-1-enyl)-1,3,5-triazin-2-yl]-3-methylbut-2-enamide (PubChem CID 54529890) has the molecular formula C20H24ClN5O and a molecular weight of 385.90 g/mol. Its IUPAC name is N-[4-[1-(4-chlorophenyl)ethylamino]-6-(2-methylprop-1-enyl)-1,3,5-triazin-2-yl]-3-methylbut-2-enamide.
| Compound Name | N-[4-[1-(4-chlorophenyl)ethylamino]-6-(2-methylprop-1-enyl)-1,3,5-triazin-2-yl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 54529890 |
| Molecular Formula | C20H24ClN5O |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-[4-[1-(4-chlorophenyl)ethylamino]-6-(2-methylprop-1-enyl)-1,3,5-triazin-2-yl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1nc(C=C(C)C)nc(NC(C)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H24ClN5O/c1-12(2)10-17-23-19(22-14(5)15-6-8-16(21)9-7-15)26-20(24-17)25-18(27)11-13(3)4/h6-11,14H,1-5H3,(H2,22,23,24,25,26,27) |
| InChIKey | YVTHKZQAYGUKAP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|