C24H24N2O6S2 — CID 5453114
(1E)-1-[(2-methoxyphenyl)hydrazinylidene]-1,3-bis-(4-methylphenyl)sulfonylpropan-2-one (PubChem CID 5453114) has the molecular formula C24H24N2O6S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is (1E)-1-[(2-methoxyphenyl)hydrazinylidene]-1,3-bis-(4-methylphenyl)sulfonylpropan-2-one.
| Compound Name | (1E)-1-[(2-methoxyphenyl)hydrazinylidene]-1,3-bis-(4-methylphenyl)sulfonylpropan-2-one |
|---|---|
| PubChem CID | 5453114 |
| Molecular Formula | C24H24N2O6S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | (1E)-1-[(2-methoxyphenyl)hydrazinylidene]-1,3-bis-(4-methylphenyl)sulfonylpropan-2-one |
| SMILES | COc1ccccc1N/N=C(\C(=O)CS(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H24N2O6S2/c1-17-8-12-19(13-9-17)33(28,29)16-22(27)24(26-25-21-6-4-5-7-23(21)32-3)34(30,31)20-14-10-18(2)11-15-20/h4-15,25H,16H2,1-3H3/b26-24+ |
| InChIKey | VAMHBCUUMXAPIV-SHHOIMCASA-N |
| XLogP | 3.55 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|