C19H22N2O6S — CID 9470869
N'-[2-(2-methoxyphenoxy)acetyl]-3-(4-methylphenyl)sulfonylpropanehydrazide (PubChem CID 9470869) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is N'-[2-(2-methoxyphenoxy)acetyl]-3-(4-methylphenyl)sulfonylpropanehydrazide.
| Compound Name | N'-[2-(2-methoxyphenoxy)acetyl]-3-(4-methylphenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 9470869 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N'-[2-(2-methoxyphenoxy)acetyl]-3-(4-methylphenyl)sulfonylpropanehydrazide |
| SMILES | COc1ccccc1OCC(=O)NNC(=O)CCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22N2O6S/c1-14-7-9-15(10-8-14)28(24,25)12-11-18(22)20-21-19(23)13-27-17-6-4-3-5-16(17)26-2/h3-10H,11-13H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | SFHRURKAVQBSGH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|