C9H15N3 — CID 54535354
(1Z,6R)-5-azido-6-methylcyclooctene (PubChem CID 54535354) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is (1Z,6R)-5-azido-6-methylcyclooctene.
| Compound Name | (1Z,6R)-5-azido-6-methylcyclooctene |
|---|---|
| PubChem CID | 54535354 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (1Z,6R)-5-azido-6-methylcyclooctene |
| SMILES | C[C@@H]1CC/C=C\CCC1N=[N+]=[N-] |
| InChI | InChI=1S/C9H15N3/c1-8-6-4-2-3-5-7-9(8)11-12-10/h2-3,8-9H,4-7H2,1H3/b3-2-/t8-,9?/m1/s1 |
| InChIKey | YZJRBQRGNGNVHT-VNARCXTPSA-N |
| XLogP | 3.43 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|