C49H74NO8P — CID 54536727
2-aminoethyl [23-[(1S)-1,2-dihydroxyethyl]-22,24-dioxopentatetraconta-10,12,14,16,18,20,25,27,29,31,33,35-dodecaen-23-yl] hydrogen phosphate (PubChem CID 54536727) has the molecular formula C49H74NO8P and a molecular weight of 836.10 g/mol. Its IUPAC name is 2-aminoethyl [23-[(1S)-1,2-dihydroxyethyl]-22,24-dioxopentatetraconta-10,12,14,16,18,20,25,27,29,31,33,35-dodecaen-23-yl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [23-[(1S)-1,2-dihydroxyethyl]-22,24-dioxopentatetraconta-10,12,14,16,18,20,25,27,29,31,33,35-dodecaen-23-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 54536727 |
| Molecular Formula | C49H74NO8P |
| Molecular Weight | 836.10 g/mol |
| Exact Mass | 835.52 |
| IUPAC Name | 2-aminoethyl [23-[(1S)-1,2-dihydroxyethyl]-22,24-dioxopentatetraconta-10,12,14,16,18,20,25,27,29,31,33,35-dodecaen-23-yl] hydrogen phosphate |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)C(OP(=O)(O)OCCN)(C(=O)C=CC=CC=CC=CC=CC=CCCCCCCCCC)[C@@H](O)CO |
| InChI | InChI=1S/C49H74NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-46(52)49(48(54)45-51,58-59(55,56)57-44-43-50)47(53)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h19-42,48,51,54H,3-18,43-45,50H2,1-2H3,(H,55,56)/t48-,49?/m0/s1 |
| InChIKey | ZAHMHZYOIJJGOL-GIIAILMYSA-N |
| XLogP | 11.26 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.10 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|