C45H76NO8P — CID 142722034
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] docosa-2,4,6,8,10,12-hexaenoate (PubChem CID 142722034) has the molecular formula C45H76NO8P and a molecular weight of 790.08 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] docosa-2,4,6,8,10,12-hexaenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] docosa-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 142722034 |
| Molecular Formula | C45H76NO8P |
| Molecular Weight | 790.08 g/mol |
| Exact Mass | 789.53 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] docosa-2,4,6,8,10,12-hexaenoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)C=CC=CC=CC=CC=CC=CCCCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C45H76NO8P/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-25-27-29-31-33-35-37-44(47)51-41-43(42-53-55(49,50)52-40-39-46)54-45(48)38-36-34-32-30-28-26-23-18-16-14-12-10-8-6-4-2/h18-25,27,29,31,33,35,37,43H,3-17,26,28,30,32,34,36,38-42,46H2,1-2H3,(H,49,50)/b20-19?,22-21?,23-18-,25-24?,29-27?,33-31?,37-35?/t43-/m1/s1 |
| InChIKey | QHKIIZFISTXGNM-MNMOKNLFSA-N |
| XLogP | 12.05 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.08 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|