C41H74NO9P — CID 156964597
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate (PubChem CID 156964597) has the molecular formula C41H74NO9P and a molecular weight of 756.01 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 156964597 |
| Molecular Formula | C41H74NO9P |
| Molecular Weight | 756.01 g/mol |
| Exact Mass | 755.51 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C41H74NO9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-24-29-33-41(45)51-39(37-50-52(46,47)49-35-34-42)36-48-40(44)32-28-25-21-23-27-31-38(43)30-26-22-19-10-8-6-4-2/h12-13,19,22,26,30,39H,3-11,14-18,20-21,23-25,27-29,31-37,42H2,1-2H3,(H,46,47)/b13-12-,22-19-,30-26+/t39-/m1/s1 |
| InChIKey | IJWQJYAKKUZPRJ-TXDPMKEISA-N |
| XLogP | 10.56 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.01 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|