C39H70NO9P — CID 156964395
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-hexadec-9-enoyl]oxypropyl] (9Z,11E)-13-oxooctadeca-9,11-dienoate (PubChem CID 156964395) has the molecular formula C39H70NO9P and a molecular weight of 727.96 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-hexadec-9-enoyl]oxypropyl] (9Z,11E)-13-oxooctadeca-9,11-dienoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-hexadec-9-enoyl]oxypropyl] (9Z,11E)-13-oxooctadeca-9,11-dienoate |
|---|---|
| PubChem CID | 156964395 |
| Molecular Formula | C39H70NO9P |
| Molecular Weight | 727.96 g/mol |
| Exact Mass | 727.48 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-hexadec-9-enoyl]oxypropyl] (9Z,11E)-13-oxooctadeca-9,11-dienoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\C=C\C(=O)CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C39H70NO9P/c1-3-5-7-8-9-10-11-12-13-16-20-23-27-31-39(43)49-37(35-48-50(44,45)47-33-32-40)34-46-38(42)30-26-22-19-17-14-15-18-21-25-29-36(41)28-24-6-4-2/h10-11,18,21,25,29,37H,3-9,12-17,19-20,22-24,26-28,30-35,40H2,1-2H3,(H,44,45)/b11-10-,21-18-,29-25+/t37-/m1/s1 |
| InChIKey | IWMSETFVMSZFAL-QEJKRWBHSA-N |
| XLogP | 9.78 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.96 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|