C41H72NO9P — CID 156964807
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,11E)-13-oxooctadeca-9,11-dienoate (PubChem CID 156964807) has the molecular formula C41H72NO9P and a molecular weight of 754.00 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,11E)-13-oxooctadeca-9,11-dienoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,11E)-13-oxooctadeca-9,11-dienoate |
|---|---|
| PubChem CID | 156964807 |
| Molecular Formula | C41H72NO9P |
| Molecular Weight | 754.00 g/mol |
| Exact Mass | 753.49 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,11E)-13-oxooctadeca-9,11-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\C=C\C(=O)CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C41H72NO9P/c1-3-5-7-8-9-10-11-12-13-14-15-18-22-25-29-33-41(45)51-39(37-50-52(46,47)49-35-34-42)36-48-40(44)32-28-24-21-19-16-17-20-23-27-31-38(43)30-26-6-4-2/h9-10,12-13,20,23,27,31,39H,3-8,11,14-19,21-22,24-26,28-30,32-37,42H2,1-2H3,(H,46,47)/b10-9-,13-12-,23-20-,31-27+/t39-/m1/s1 |
| InChIKey | WUPHIPQIOZBPQW-NNOZUUPWSA-N |
| XLogP | 10.34 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.00 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|