C45H74NO9P — CID 156987533
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10E,12Z)-9-oxooctadeca-10,12-dienoyl]oxypropan-2-yl] (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate (PubChem CID 156987533) has the molecular formula C45H74NO9P and a molecular weight of 804.06 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10E,12Z)-9-oxooctadeca-10,12-dienoyl]oxypropan-2-yl] (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10E,12Z)-9-oxooctadeca-10,12-dienoyl]oxypropan-2-yl] (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate |
|---|---|
| PubChem CID | 156987533 |
| Molecular Formula | C45H74NO9P |
| Molecular Weight | 804.06 g/mol |
| Exact Mass | 803.51 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10E,12Z)-9-oxooctadeca-10,12-dienoyl]oxypropan-2-yl] (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C45H74NO9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-28-33-37-45(49)55-43(41-54-56(50,51)53-39-38-46)40-52-44(48)36-32-29-25-27-31-35-42(47)34-30-26-23-10-8-6-4-2/h11-12,14-15,17-18,20-21,23-24,26,28,30,34,43H,3-10,13,16,19,22,25,27,29,31-33,35-41,46H2,1-2H3,(H,50,51)/b12-11-,15-14-,18-17-,21-20-,26-23-,28-24-,34-30+/t43-/m1/s1 |
| InChIKey | KIXLVMBFGDYINP-YIPBKNCTSA-N |
| XLogP | 11.23 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.06 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|